C11H17NS — CID 112715433
3-[1-(3-methylthiophen-2-yl)ethyl]pyrrolidine (PubChem CID 112715433) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 3-[1-(3-methylthiophen-2-yl)ethyl]pyrrolidine.
| Compound Name | 3-[1-(3-methylthiophen-2-yl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 112715433 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3-[1-(3-methylthiophen-2-yl)ethyl]pyrrolidine |
| SMILES | Cc1ccsc1C(C)C1CCNC1 |
| InChI | InChI=1S/C11H17NS/c1-8-4-6-13-11(8)9(2)10-3-5-12-7-10/h4,6,9-10,12H,3,5,7H2,1-2H3 |
| InChIKey | CQLPITJPZAVYRB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |