About N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine
N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 112715902) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 112715902 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | Cc1ccc2c(c1)SCC2NC1CC1 |
| InChI | InChI=1S/C12H15NS/c1-8-2-5-10-11(13-9-3-4-9)7-14-12(10)6-8/h2,5-6,9,11,13H,3-4,7H2,1H3 |
| InChIKey | DIFYCVZWQPJBOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine (CID 112715902) is N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine is Cc1ccc2c(c1)SCC2NC1CC1.
What is the InChIKey of N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is DIFYCVZWQPJBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-8-2-5-10-11(13-9-3-4-9)7-14-12(10)6-8/h2,5-6,9,11,13H,3-4,7H2,1H3.
What are the key properties of N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine?
N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 205.33 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-methyl-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 112715902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).