About 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid
2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid (PubChem CID 112716308) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid.
Analyze 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid?
The IUPAC name of 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid (CID 112716308) is 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid.
What is the SMILES notation for 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid?
The canonical SMILES for 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid is NCC1(CC(=O)O)CCCc2cn[nH]c21.
What is the InChIKey of 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid?
The InChIKey is GOEZYNTXNRRSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c11-6-10(4-8(14)15)3-1-2-7-5-12-13-9(7)10/h5H,1-4,6,11H2,(H,12,13)(H,14,15).
What are the key properties of 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid?
2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid has a molecular weight of 209.25 g/mol, XLogP of 0.42, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(aminomethyl)-1,4,5,6-tetrahydroindazol-7-yl]acetic acid is sourced from PubChem (CID 112716308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).