C19H29NOS — CID 112719238
3-(3,5-ditert-butyl-4-methoxyphenyl)propyl thiocyanate (PubChem CID 112719238) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-methoxyphenyl)propyl thiocyanate.
| Compound Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)propyl thiocyanate |
|---|---|
| PubChem CID | 112719238 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)propyl thiocyanate |
| SMILES | COc1c(C(C)(C)C)cc(CCCSC#N)cc1C(C)(C)C |
| InChI | InChI=1S/C19H29NOS/c1-18(2,3)15-11-14(9-8-10-22-13-20)12-16(17(15)21-7)19(4,5)6/h11-12H,8-10H2,1-7H3 |
| InChIKey | UYZHTKIDHCZWBV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|