C20H31N3O — CID 112719240
4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethyl]-1-methyltriazole (PubChem CID 112719240) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethyl]-1-methyltriazole.
| Compound Name | 4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethyl]-1-methyltriazole |
|---|---|
| PubChem CID | 112719240 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 4-[2-(3,5-ditert-butyl-4-methoxyphenyl)ethyl]-1-methyltriazole |
| SMILES | COc1c(C(C)(C)C)cc(CCc2cn(C)nn2)cc1C(C)(C)C |
| InChI | InChI=1S/C20H31N3O/c1-19(2,3)16-11-14(9-10-15-13-23(7)22-21-15)12-17(18(16)24-8)20(4,5)6/h11-13H,9-10H2,1-8H3 |
| InChIKey | BEZQKMDCRFSQSV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |