C14H20N4O3 — CID 107064524
2-(1-methyltriazol-4-yl)-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 107064524) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(1-methyltriazol-4-yl)-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | 2-(1-methyltriazol-4-yl)-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 107064524 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(1-methyltriazol-4-yl)-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(C(N)Cc2cn(C)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C14H20N4O3/c1-18-8-10(16-17-18)7-11(15)9-5-12(19-2)14(21-4)13(6-9)20-3/h5-6,8,11H,7,15H2,1-4H3 |
| InChIKey | WEFXCRQGQSCLOS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |