C13H14OS — CID 112725392
2-[(2,5-dimethylphenoxy)methyl]thiophene (PubChem CID 112725392) has the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenoxy)methyl]thiophene.
| Compound Name | 2-[(2,5-dimethylphenoxy)methyl]thiophene |
|---|---|
| PubChem CID | 112725392 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-[(2,5-dimethylphenoxy)methyl]thiophene |
| SMILES | Cc1ccc(C)c(OCc2cccs2)c1 |
| InChI | InChI=1S/C13H14OS/c1-10-5-6-11(2)13(8-10)14-9-12-4-3-7-15-12/h3-8H,9H2,1-2H3 |
| InChIKey | GRXKEXACDGRUSV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |