C15H27NO2S — CID 112726263
1-(4-methylpentan-2-yloxy)-3-[(3-methylthiophen-2-yl)methylamino]propan-2-ol (PubChem CID 112726263) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-(4-methylpentan-2-yloxy)-3-[(3-methylthiophen-2-yl)methylamino]propan-2-ol.
| Compound Name | 1-(4-methylpentan-2-yloxy)-3-[(3-methylthiophen-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 112726263 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-(4-methylpentan-2-yloxy)-3-[(3-methylthiophen-2-yl)methylamino]propan-2-ol |
| SMILES | Cc1ccsc1CNCC(O)COC(C)CC(C)C |
| InChI | InChI=1S/C15H27NO2S/c1-11(2)7-13(4)18-10-14(17)8-16-9-15-12(3)5-6-19-15/h5-6,11,13-14,16-17H,7-10H2,1-4H3 |
| InChIKey | LOWAWQNMNHXVSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |