C30H33F2N5O3 — CID 11272817
2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2,6-difluorophenyl]-2-methylpropanenitrile (PubChem CID 11272817) has the molecular formula C30H33F2N5O3 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2,6-difluorophenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2,6-difluorophenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 11272817 |
| Molecular Formula | C30H33F2N5O3 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2,6-difluorophenyl]-2-methylpropanenitrile |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4cc(F)c(C(C)(C)C#N)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C30H33F2N5O3/c1-17-11-18(2)37-28(34-17)35-25(36-37)14-21-24(38)15-30(40-27(21)39,20-7-5-6-8-20)10-9-19-12-22(31)26(23(32)13-19)29(3,4)16-33/h11-13,20-21H,5-10,14-15H2,1-4H3 |
| InChIKey | FBABMYMWHBCXLZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 110.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|