C30H32FN5O3 — CID 11478083
1-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]cyclopropane-1-carbonitrile (PubChem CID 11478083) has the molecular formula C30H32FN5O3 and a molecular weight of 529.62 g/mol. Its IUPAC name is 1-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 11478083 |
| Molecular Formula | C30H32FN5O3 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4ccc(C5(C#N)CC5)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C30H32FN5O3/c1-18-13-19(2)36-28(33-18)34-26(35-36)15-22-25(37)16-30(39-27(22)38,21-5-3-4-6-21)10-9-20-7-8-23(24(31)14-20)29(17-32)11-12-29/h7-8,13-14,21-22H,3-6,9-12,15-16H2,1-2H3 |
| InChIKey | SACBHSMDIOCALM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 110.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|