C14H17N3O4 — CID 112728765
N-[3-(2-amino-2-oxoethoxy)phenyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112728765) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112728765 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-6-oxopiperidine-3-carboxamide |
| SMILES | NC(=O)COc1cccc(NC(=O)C2CCC(=O)NC2)c1 |
| InChI | InChI=1S/C14H17N3O4/c15-12(18)8-21-11-3-1-2-10(6-11)17-14(20)9-4-5-13(19)16-7-9/h1-3,6,9H,4-5,7-8H2,(H2,15,18)(H,16,19)(H,17,20) |
| InChIKey | GEDXKFICNCYXIJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |