C11H11N3O2S — CID 112729096
N-(3-cyanothiophen-2-yl)-6-oxopiperidine-3-carboxamide (PubChem CID 112729096) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112729096 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-6-oxopiperidine-3-carboxamide |
| SMILES | N#Cc1ccsc1NC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C11H11N3O2S/c12-5-7-3-4-17-11(7)14-10(16)8-1-2-9(15)13-6-8/h3-4,8H,1-2,6H2,(H,13,15)(H,14,16) |
| InChIKey | AQFAXRGRBQQZRT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |