C24H36N2O6S4 — CID 11273185
3-amino-4-[(4-amino-1-phenyl-6-sulfohexan-3-yl)disulfanyl]-6-phenylhexane-1-sulfonic acid (PubChem CID 11273185) has the molecular formula C24H36N2O6S4 and a molecular weight of 576.83 g/mol. Its IUPAC name is 3-amino-4-[(4-amino-1-phenyl-6-sulfohexan-3-yl)disulfanyl]-6-phenylhexane-1-sulfonic acid.
| Compound Name | 3-amino-4-[(4-amino-1-phenyl-6-sulfohexan-3-yl)disulfanyl]-6-phenylhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 11273185 |
| Molecular Formula | C24H36N2O6S4 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 3-amino-4-[(4-amino-1-phenyl-6-sulfohexan-3-yl)disulfanyl]-6-phenylhexane-1-sulfonic acid |
| SMILES | NC(CCS(=O)(=O)O)C(CCc1ccccc1)SSC(CCc1ccccc1)C(N)CCS(=O)(=O)O |
| InChI | InChI=1S/C24H36N2O6S4/c25-21(15-17-35(27,28)29)23(13-11-19-7-3-1-4-8-19)33-34-24(22(26)16-18-36(30,31)32)14-12-20-9-5-2-6-10-20/h1-10,21-24H,11-18,25-26H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | QKXICSROCYFXSX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|