C21H18ClF3N4O3 — CID 1127335
(5R,7R)-N-(5-chloro-2-hydroxyphenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1127335) has the molecular formula C21H18ClF3N4O3 and a molecular weight of 466.85 g/mol. Its IUPAC name is (5R,7R)-N-(5-chloro-2-hydroxyphenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-(5-chloro-2-hydroxyphenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1127335 |
| Molecular Formula | C21H18ClF3N4O3 |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | (5R,7R)-N-(5-chloro-2-hydroxyphenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)Nc4cc(Cl)ccc4O)c3N2)cc1 |
| InChI | InChI=1S/C21H18ClF3N4O3/c1-32-13-5-2-11(3-6-13)15-9-18(21(23,24)25)29-19(27-15)14(10-26-29)20(31)28-16-8-12(22)4-7-17(16)30/h2-8,10,15,18,27,30H,9H2,1H3,(H,28,31)/t15-,18-/m1/s1 |
| InChIKey | NUYXFKDSKSHKIT-CRAIPNDOSA-N |
| XLogP | 5.16 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|