C22H20ClF3N4O2 — CID 1140980
(5R,7R)-N-(3-chloro-2-methylphenyl)-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1140980) has the molecular formula C22H20ClF3N4O2 and a molecular weight of 464.88 g/mol. Its IUPAC name is (5R,7R)-N-(3-chloro-2-methylphenyl)-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-(3-chloro-2-methylphenyl)-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1140980 |
| Molecular Formula | C22H20ClF3N4O2 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (5R,7R)-N-(3-chloro-2-methylphenyl)-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cccc([C@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)Nc4cccc(Cl)c4C)c3N2)c1 |
| InChI | InChI=1S/C22H20ClF3N4O2/c1-12-16(23)7-4-8-17(12)29-21(31)15-11-27-30-19(22(24,25)26)10-18(28-20(15)30)13-5-3-6-14(9-13)32-2/h3-9,11,18-19,28H,10H2,1-2H3,(H,29,31)/t18-,19-/m1/s1 |
| InChIKey | AEEZTTOLYQOFJS-RTBURBONSA-N |
| XLogP | 5.77 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |