C21H25F3N4O2 — CID 1141071
(5R,7R)-N-cyclohexyl-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1141071) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is (5R,7R)-N-cyclohexyl-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-cyclohexyl-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1141071 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (5R,7R)-N-cyclohexyl-5-(3-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cccc([C@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)NC4CCCCC4)c3N2)c1 |
| InChI | InChI=1S/C21H25F3N4O2/c1-30-15-9-5-6-13(10-15)17-11-18(21(22,23)24)28-19(27-17)16(12-25-28)20(29)26-14-7-3-2-4-8-14/h5-6,9-10,12,14,17-18,27H,2-4,7-8,11H2,1H3,(H,26,29)/t17-,18-/m1/s1 |
| InChIKey | KCOGZWJQJJXTPY-QZTJIDSGSA-N |
| XLogP | 4.61 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |