C21H25F3N4O3 — CID 1127044
(5S,7R)-N-cyclopentyl-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1127044) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is (5S,7R)-N-cyclopentyl-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7R)-N-cyclopentyl-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1127044 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (5S,7R)-N-cyclopentyl-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc([C@@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)NC4CCCC4)c3N2)cc1OC |
| InChI | InChI=1S/C21H25F3N4O3/c1-30-16-8-7-12(9-17(16)31-2)15-10-18(21(22,23)24)28-19(27-15)14(11-25-28)20(29)26-13-5-3-4-6-13/h7-9,11,13,15,18,27H,3-6,10H2,1-2H3,(H,26,29)/t15-,18+/m0/s1 |
| InChIKey | LBWOOPQEVHQFFQ-MAUKXSAKSA-N |
| XLogP | 4.23 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |