C16H15F3N3O4- — CID 3332999
5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 3332999) has the molecular formula C16H15F3N3O4- and a molecular weight of 370.31 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | 5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 3332999 |
| Molecular Formula | C16H15F3N3O4- |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | COc1ccc(C2CC(C(F)(F)F)n3ncc(C(=O)[O-])c3N2)cc1OC |
| InChI | InChI=1S/C16H16F3N3O4/c1-25-11-4-3-8(5-12(11)26-2)10-6-13(16(17,18)19)22-14(21-10)9(7-20-22)15(23)24/h3-5,7,10,13,21H,6H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | GJZRYLIDOYMMKF-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |