C20H23F3N4O4 — CID 1127000
[(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 1127000) has the molecular formula C20H23F3N4O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is [(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 1127000 |
| Molecular Formula | C20H23F3N4O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(5R,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)N4CCOCC4)c3N2)cc1OC |
| InChI | InChI=1S/C20H23F3N4O4/c1-29-15-4-3-12(9-16(15)30-2)14-10-17(20(21,22)23)27-18(25-14)13(11-24-27)19(28)26-5-7-31-8-6-26/h3-4,9,11,14,17,25H,5-8,10H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | XMXUHXZKWUCLNQ-PBHICJAKSA-N |
| XLogP | 3.03 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |