C22H27F3N4O3 — CID 136853641
[(5S,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 136853641) has the molecular formula C22H27F3N4O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is [(5S,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(5S,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 136853641 |
| Molecular Formula | C22H27F3N4O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [(5S,7S)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccc([C@@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)N4CCC(C)CC4)c3N2)cc1OC |
| InChI | InChI=1S/C22H27F3N4O3/c1-13-6-8-28(9-7-13)21(30)15-12-26-29-19(22(23,24)25)11-16(27-20(15)29)14-4-5-17(31-2)18(10-14)32-3/h4-5,10,12-13,16,19,27H,6-9,11H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | NFSZSZUSFRMLAC-LPHOPBHVSA-N |
| XLogP | 4.43 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |