C24H30F3N5O5 — CID 2981143
ethyl 4-[[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 2981143) has the molecular formula C24H30F3N5O5 and a molecular weight of 525.53 g/mol. Its IUPAC name is ethyl 4-[[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 2981143 |
| Molecular Formula | C24H30F3N5O5 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | ethyl 4-[[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cnn3c2NC(c2ccc(OC)c(OC)c2)CC3C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H30F3N5O5/c1-4-37-23(34)31-9-7-15(8-10-31)29-22(33)16-13-28-32-20(24(25,26)27)12-17(30-21(16)32)14-5-6-18(35-2)19(11-14)36-3/h5-6,11,13,15,17,20,30H,4,7-10,12H2,1-3H3,(H,29,33) |
| InChIKey | FXHPWQXMYBONMJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |