C20H24F3N5O4 — CID 1257293
ethyl 4-[[(5R,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 1257293) has the molecular formula C20H24F3N5O4 and a molecular weight of 455.44 g/mol. Its IUPAC name is ethyl 4-[[(5R,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(5R,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 1257293 |
| Molecular Formula | C20H24F3N5O4 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 4-[[(5R,7S)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cnn3c2N[C@@H](c2ccco2)C[C@H]3C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H24F3N5O4/c1-2-31-19(30)27-7-5-12(6-8-27)25-18(29)13-11-24-28-16(20(21,22)23)10-14(26-17(13)28)15-4-3-9-32-15/h3-4,9,11-12,14,16,26H,2,5-8,10H2,1H3,(H,25,29)/t14-,16+/m1/s1 |
| InChIKey | YSMNZRXMNJGVBK-ZBFHGGJFSA-N |
| XLogP | 3.49 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |