C22H26F3N5O3 — CID 136853731
ethyl 4-[(5S,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 136853731) has the molecular formula C22H26F3N5O3 and a molecular weight of 465.48 g/mol. Its IUPAC name is ethyl 4-[(5S,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(5S,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 136853731 |
| Molecular Formula | C22H26F3N5O3 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | ethyl 4-[(5S,7S)-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cnn3c2N[C@H](c2ccc(C)cc2)C[C@H]3C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H26F3N5O3/c1-3-33-21(32)29-10-8-28(9-11-29)20(31)16-13-26-30-18(22(23,24)25)12-17(27-19(16)30)15-6-4-14(2)5-7-15/h4-7,13,17-18,27H,3,8-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | FEKORJACWZWZLU-ROUUACIJSA-N |
| XLogP | 3.77 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |