C20H24F3N5O — CID 135847330
(4-ethylpiperazin-1-yl)-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 135847330) has the molecular formula C20H24F3N5O and a molecular weight of 407.44 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 135847330 |
| Molecular Formula | C20H24F3N5O |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cnn3c2N[C@H](c2ccccc2)C[C@@H]3C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H24F3N5O/c1-2-26-8-10-27(11-9-26)19(29)15-13-24-28-17(20(21,22)23)12-16(25-18(15)28)14-6-4-3-5-7-14/h3-7,13,16-17,25H,2,8-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UUIMAYFLCRSSSC-DLBZAZTESA-N |
| XLogP | 3.32 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |