C22H27F3N4O2 — CID 1141178
(5S,7S)-N-cyclohexyl-5-(3-methoxyphenyl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1141178) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is (5S,7S)-N-cyclohexyl-5-(3-methoxyphenyl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-N-cyclohexyl-5-(3-methoxyphenyl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1141178 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (5S,7S)-N-cyclohexyl-5-(3-methoxyphenyl)-N-methyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cccc([C@@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)N(C)C4CCCCC4)c3N2)c1 |
| InChI | InChI=1S/C22H27F3N4O2/c1-28(15-8-4-3-5-9-15)21(30)17-13-26-29-19(22(23,24)25)12-18(27-20(17)29)14-7-6-10-16(11-14)31-2/h6-7,10-11,13,15,18-19,27H,3-5,8-9,12H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | CRYVPNMIADEVKM-OALUTQOASA-N |
| XLogP | 4.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |