About N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine
N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine (PubChem CID 112736749) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine |
| PubChem CID | 112736749 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine |
| SMILES | CCC(C)(C)N(C)C[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H24N2/c1-5-15(2,3)17(4)11-13-10-12-8-6-7-9-14(12)16-13/h6-9,13,16H,5,10-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | MPFBWGZKFVAZPF-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The IUPAC name of N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine (CID 112736749) is N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine.
What is the SMILES notation for N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The canonical SMILES for N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine is CCC(C)(C)N(C)C[C@@H]1Cc2ccccc2N1.
What is the InChIKey of N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The InChIKey is MPFBWGZKFVAZPF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H24N2/c1-5-15(2,3)17(4)11-13-10-12-8-6-7-9-14(12)16-13/h6-9,13,16H,5,10-11H2,1-4H3/t13-/m0/s1.
What are the key properties of N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine?
N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine has a molecular weight of 232.37 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-2,3-dihydro-1H-indol-2-yl]methyl]-N,2-dimethylbutan-2-amine is sourced from PubChem (CID 112736749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).