C13H20F2N2O — CID 112737551
1-[2-amino-4-(difluoromethyl)anilino]-4-methylpentan-2-ol (PubChem CID 112737551) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-[2-amino-4-(difluoromethyl)anilino]-4-methylpentan-2-ol.
| Compound Name | 1-[2-amino-4-(difluoromethyl)anilino]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 112737551 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-[2-amino-4-(difluoromethyl)anilino]-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)CNc1ccc(C(F)F)cc1N |
| InChI | InChI=1S/C13H20F2N2O/c1-8(2)5-10(18)7-17-12-4-3-9(13(14)15)6-11(12)16/h3-4,6,8,10,13,17-18H,5,7,16H2,1-2H3 |
| InChIKey | AFOJTEGXBMNGCE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|