C40H40O7S — CID 11273847
(2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 11273847) has the molecular formula C40H40O7S and a molecular weight of 664.82 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 11273847 |
| Molecular Formula | C40H40O7S |
| Molecular Weight | 664.82 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(benzenesulfonyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H40O7S/c41-48(42,35-24-14-5-15-25-35)40-39(46-29-34-22-12-4-13-23-34)38(45-28-33-20-10-3-11-21-33)37(44-27-32-18-8-2-9-19-32)36(47-40)30-43-26-31-16-6-1-7-17-31/h1-25,36-40H,26-30H2/t36-,37-,38+,39-,40+/m1/s1 |
| InChIKey | XBZBAXAVVNVYQO-DTQLOPILSA-N |
| XLogP | 7.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.82 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |