C14H21N3 — CID 112741845
N-(2,4-dimethyl-3-pyridinyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 112741845) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2,4-dimethyl-3-pyridinyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(2,4-dimethyl-3-pyridinyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 112741845 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-(2,4-dimethyl-3-pyridinyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Cc1ccnc(C)c1NC1CCN2CCCC12 |
| InChI | InChI=1S/C14H21N3/c1-10-5-7-15-11(2)14(10)16-12-6-9-17-8-3-4-13(12)17/h5,7,12-13,16H,3-4,6,8-9H2,1-2H3 |
| InChIKey | UUQBYCTZBWTJSR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |