C13H15BrClN3O — CID 112742100
3-(5-bromo-2-methoxyphenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole (PubChem CID 112742100) has the molecular formula C13H15BrClN3O and a molecular weight of 344.64 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112742100 |
| Molecular Formula | C13H15BrClN3O |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1c(CCl)nnc1-c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H15BrClN3O/c1-3-6-18-12(8-15)16-17-13(18)10-7-9(14)4-5-11(10)19-2/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | KMTLDSARACQRGN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|