C12H12Cl2FN3 — CID 113302114
3-(5-chloro-2-fluorophenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole (PubChem CID 113302114) has the molecular formula C12H12Cl2FN3 and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 113302114 |
| Molecular Formula | C12H12Cl2FN3 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-5-(chloromethyl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1c(CCl)nnc1-c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H12Cl2FN3/c1-2-5-18-11(7-13)16-17-12(18)9-6-8(14)3-4-10(9)15/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | SSBPIKCEXFTHAF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|