About 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one
4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one (PubChem CID 112742456) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one |
| PubChem CID | 112742456 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one |
| SMILES | Cc1cnn(C)c1C(=O)CCC(CCN)C(C)(C)C |
| InChI | InChI=1S/C15H27N3O/c1-11-10-17-18(5)14(11)13(19)7-6-12(8-9-16)15(2,3)4/h10,12H,6-9,16H2,1-5H3 |
| InChIKey | HULZWWVVGVUMOD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one?
The IUPAC name of 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one (CID 112742456) is 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one.
What is the SMILES notation for 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one?
The canonical SMILES for 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one is Cc1cnn(C)c1C(=O)CCC(CCN)C(C)(C)C.
What is the InChIKey of 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one?
The InChIKey is HULZWWVVGVUMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O/c1-11-10-17-18(5)14(11)13(19)7-6-12(8-9-16)15(2,3)4/h10,12H,6-9,16H2,1-5H3.
What are the key properties of 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one?
4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one has a molecular weight of 265.40 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1-(1,4-dimethylpyrazol-5-yl)-5,5-dimethylhexan-1-one is sourced from PubChem (CID 112742456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).