C14H23NOS — CID 116578558
4-(2-aminoethyl)-5,5-dimethyl-1-thiophen-2-ylhexan-1-one (PubChem CID 116578558) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5,5-dimethyl-1-thiophen-2-ylhexan-1-one.
| Compound Name | 4-(2-aminoethyl)-5,5-dimethyl-1-thiophen-2-ylhexan-1-one |
|---|---|
| PubChem CID | 116578558 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(2-aminoethyl)-5,5-dimethyl-1-thiophen-2-ylhexan-1-one |
| SMILES | CC(C)(C)C(CCN)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C14H23NOS/c1-14(2,3)11(8-9-15)6-7-12(16)13-5-4-10-17-13/h4-5,10-11H,6-9,15H2,1-3H3 |
| InChIKey | JGWCXWIUTDQQFL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |