C9H12F2N4O3 — CID 112743123
ethyl 2,2-difluoro-3-oxo-3-[2-(triazol-1-yl)ethylamino]propanoate (PubChem CID 112743123) has the molecular formula C9H12F2N4O3 and a molecular weight of 262.22 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-oxo-3-[2-(triazol-1-yl)ethylamino]propanoate.
| Compound Name | ethyl 2,2-difluoro-3-oxo-3-[2-(triazol-1-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 112743123 |
| Molecular Formula | C9H12F2N4O3 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | ethyl 2,2-difluoro-3-oxo-3-[2-(triazol-1-yl)ethylamino]propanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C9H12F2N4O3/c1-2-18-8(17)9(10,11)7(16)12-3-5-15-6-4-13-14-15/h4,6H,2-3,5H2,1H3,(H,12,16) |
| InChIKey | FRJCQBIDYCWQFF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|