C8H11F3N4O2 — CID 113411902
2,2,2-trifluoroethyl N-[3-(triazol-1-yl)propyl]carbamate (PubChem CID 113411902) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-(triazol-1-yl)propyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[3-(triazol-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 113411902 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-(triazol-1-yl)propyl]carbamate |
| SMILES | O=C(NCCCn1ccnn1)OCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2/c9-8(10,11)6-17-7(16)12-2-1-4-15-5-3-13-14-15/h3,5H,1-2,4,6H2,(H,12,16) |
| InChIKey | NRBGMOORJJSTDE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|