C15H28N2 — CID 112743338
2,2-dicyclopropyl-2-(3,4-dimethylpiperidin-1-yl)ethanamine (PubChem CID 112743338) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 2,2-dicyclopropyl-2-(3,4-dimethylpiperidin-1-yl)ethanamine.
| Compound Name | 2,2-dicyclopropyl-2-(3,4-dimethylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 112743338 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 2,2-dicyclopropyl-2-(3,4-dimethylpiperidin-1-yl)ethanamine |
| SMILES | CC1CCN(C(CN)(C2CC2)C2CC2)CC1C |
| InChI | InChI=1S/C15H28N2/c1-11-7-8-17(9-12(11)2)15(10-16,13-3-4-13)14-5-6-14/h11-14H,3-10,16H2,1-2H3 |
| InChIKey | SILPFJDXMSMFFT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |