C12H13ClIN3O — CID 112744845
(3-chloro-4-iodophenyl)-(2-propan-2-yl-1,2,4-triazol-3-yl)methanol (PubChem CID 112744845) has the molecular formula C12H13ClIN3O and a molecular weight of 377.61 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2-propan-2-yl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (3-chloro-4-iodophenyl)-(2-propan-2-yl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 112744845 |
| Molecular Formula | C12H13ClIN3O |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2-propan-2-yl-1,2,4-triazol-3-yl)methanol |
| SMILES | CC(C)n1ncnc1C(O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClIN3O/c1-7(2)17-12(15-6-16-17)11(18)8-3-4-10(14)9(13)5-8/h3-7,11,18H,1-2H3 |
| InChIKey | JNZQCXSMGYBQHF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|