C13H13ClINO — CID 114273349
(3-chloro-4-iodophenyl)-(3,4-dimethyl-1H-pyrrol-2-yl)methanol (PubChem CID 114273349) has the molecular formula C13H13ClINO and a molecular weight of 361.61 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(3,4-dimethyl-1H-pyrrol-2-yl)methanol.
| Compound Name | (3-chloro-4-iodophenyl)-(3,4-dimethyl-1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 114273349 |
| Molecular Formula | C13H13ClINO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(3,4-dimethyl-1H-pyrrol-2-yl)methanol |
| SMILES | Cc1c[nH]c(C(O)c2ccc(I)c(Cl)c2)c1C |
| InChI | InChI=1S/C13H13ClINO/c1-7-6-16-12(8(7)2)13(17)9-3-4-11(15)10(14)5-9/h3-6,13,16-17H,1-2H3 |
| InChIKey | DVAJTZIDNZTBTF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|