C15H25NO3 — CID 112744942
2-[[2,2-di(cyclobutyl)acetyl]-propylamino]acetic acid (PubChem CID 112744942) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-[[2,2-di(cyclobutyl)acetyl]-propylamino]acetic acid.
| Compound Name | 2-[[2,2-di(cyclobutyl)acetyl]-propylamino]acetic acid |
|---|---|
| PubChem CID | 112744942 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-[[2,2-di(cyclobutyl)acetyl]-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)C(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C15H25NO3/c1-2-9-16(10-13(17)18)15(19)14(11-5-3-6-11)12-7-4-8-12/h11-12,14H,2-10H2,1H3,(H,17,18) |
| InChIKey | KTFNZVFSPCRUBN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |