C11H19NO5S — CID 104517504
2-[(1,1-dioxothiane-2-carbonyl)-propylamino]acetic acid (PubChem CID 104517504) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothiane-2-carbonyl)-propylamino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiane-2-carbonyl)-propylamino]acetic acid |
|---|---|
| PubChem CID | 104517504 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[(1,1-dioxothiane-2-carbonyl)-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H19NO5S/c1-2-6-12(8-10(13)14)11(15)9-5-3-4-7-18(9,16)17/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | GBAXDVVWOLAFGB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |