C14H23Br2NO — CID 112745153
2,2-di(cyclobutyl)-N-(1,3-dibromo-2-methylpropan-2-yl)acetamide (PubChem CID 112745153) has the molecular formula C14H23Br2NO and a molecular weight of 381.15 g/mol. Its IUPAC name is 2,2-di(cyclobutyl)-N-(1,3-dibromo-2-methylpropan-2-yl)acetamide.
| Compound Name | 2,2-di(cyclobutyl)-N-(1,3-dibromo-2-methylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 112745153 |
| Molecular Formula | C14H23Br2NO |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 2,2-di(cyclobutyl)-N-(1,3-dibromo-2-methylpropan-2-yl)acetamide |
| SMILES | CC(CBr)(CBr)NC(=O)C(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C14H23Br2NO/c1-14(8-15,9-16)17-13(18)12(10-4-2-5-10)11-6-3-7-11/h10-12H,2-9H2,1H3,(H,17,18) |
| InChIKey | FSCOBKRXGXAXRC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|