C15H20O4 — CID 112745923
3-ethoxy-4-(2-hydroxy-2-methylcyclopentyl)oxybenzaldehyde (PubChem CID 112745923) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-ethoxy-4-(2-hydroxy-2-methylcyclopentyl)oxybenzaldehyde.
| Compound Name | 3-ethoxy-4-(2-hydroxy-2-methylcyclopentyl)oxybenzaldehyde |
|---|---|
| PubChem CID | 112745923 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-ethoxy-4-(2-hydroxy-2-methylcyclopentyl)oxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OC1CCCC1(C)O |
| InChI | InChI=1S/C15H20O4/c1-3-18-13-9-11(10-16)6-7-12(13)19-14-5-4-8-15(14,2)17/h6-7,9-10,14,17H,3-5,8H2,1-2H3 |
| InChIKey | YXQILFVTXARYSK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|