C11H11FN2O3 — CID 112746853
4-[[(E)-4-aminobut-2-enoyl]amino]-2-fluorobenzoic acid (PubChem CID 112746853) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-[[(E)-4-aminobut-2-enoyl]amino]-2-fluorobenzoic acid.
| Compound Name | 4-[[(E)-4-aminobut-2-enoyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 112746853 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-[[(E)-4-aminobut-2-enoyl]amino]-2-fluorobenzoic acid |
| SMILES | NC/C=C/C(=O)Nc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C11H11FN2O3/c12-9-6-7(3-4-8(9)11(16)17)14-10(15)2-1-5-13/h1-4,6H,5,13H2,(H,14,15)(H,16,17)/b2-1+ |
| InChIKey | APVUDISHIKLTPF-OWOJBTEDSA-N |
| XLogP | 0.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|