C11H10F4N2O — CID 112746811
(E)-4-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 112746811) has the molecular formula C11H10F4N2O and a molecular weight of 262.21 g/mol. Its IUPAC name is (E)-4-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | (E)-4-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 112746811 |
| Molecular Formula | C11H10F4N2O |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (E)-4-amino-N-[4-fluoro-3-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | NC/C=C/C(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F4N2O/c12-9-4-3-7(6-8(9)11(13,14)15)17-10(18)2-1-5-16/h1-4,6H,5,16H2,(H,17,18)/b2-1+ |
| InChIKey | XMGSRQFVPQGFQB-OWOJBTEDSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|