C13H18BrNO3S — CID 112746951
N-(5-bromo-2-methoxyphenyl)-2-cyclobutylethanesulfonamide (PubChem CID 112746951) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-2-cyclobutylethanesulfonamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-2-cyclobutylethanesulfonamide |
|---|---|
| PubChem CID | 112746951 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-2-cyclobutylethanesulfonamide |
| SMILES | COc1ccc(Br)cc1NS(=O)(=O)CCC1CCC1 |
| InChI | InChI=1S/C13H18BrNO3S/c1-18-13-6-5-11(14)9-12(13)15-19(16,17)8-7-10-3-2-4-10/h5-6,9-10,15H,2-4,7-8H2,1H3 |
| InChIKey | IEZMSHDOZMXXIY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |