C13H21N3O — CID 112747102
5-(3,3-dimethylpiperidin-4-yl)oxy-2,3-dimethylpyrazine (PubChem CID 112747102) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-(3,3-dimethylpiperidin-4-yl)oxy-2,3-dimethylpyrazine.
| Compound Name | 5-(3,3-dimethylpiperidin-4-yl)oxy-2,3-dimethylpyrazine |
|---|---|
| PubChem CID | 112747102 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 5-(3,3-dimethylpiperidin-4-yl)oxy-2,3-dimethylpyrazine |
| SMILES | Cc1ncc(OC2CCNCC2(C)C)nc1C |
| InChI | InChI=1S/C13H21N3O/c1-9-10(2)16-12(7-15-9)17-11-5-6-14-8-13(11,3)4/h7,11,14H,5-6,8H2,1-4H3 |
| InChIKey | QCLFIGAOGCKAIJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |