C13H20N2O4 — CID 112747210
2-[(4-hydroxy-3,3-dimethylpiperidine-1-carbonyl)amino]pent-4-ynoic acid (PubChem CID 112747210) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,3-dimethylpiperidine-1-carbonyl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(4-hydroxy-3,3-dimethylpiperidine-1-carbonyl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 112747210 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[(4-hydroxy-3,3-dimethylpiperidine-1-carbonyl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)N1CCC(O)C(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-4-5-9(11(17)18)14-12(19)15-7-6-10(16)13(2,3)8-15/h1,9-10,16H,5-8H2,2-3H3,(H,14,19)(H,17,18) |
| InChIKey | ALOZDMGZNADNNZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|