C14H21FN2O — CID 112747815
1-[1-[4-(aminomethyl)-3-fluorophenyl]pyrrolidin-2-yl]propan-2-ol (PubChem CID 112747815) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 1-[1-[4-(aminomethyl)-3-fluorophenyl]pyrrolidin-2-yl]propan-2-ol.
| Compound Name | 1-[1-[4-(aminomethyl)-3-fluorophenyl]pyrrolidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 112747815 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-[1-[4-(aminomethyl)-3-fluorophenyl]pyrrolidin-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCN1c1ccc(CN)c(F)c1 |
| InChI | InChI=1S/C14H21FN2O/c1-10(18)7-12-3-2-6-17(12)13-5-4-11(9-16)14(15)8-13/h4-5,8,10,12,18H,2-3,6-7,9,16H2,1H3 |
| InChIKey | PTIIFXSWUBKJTI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |