C15H17BrN2 — CID 112748091
2-[2-(2-bromoethyl)pyrrolidin-1-yl]quinoline (PubChem CID 112748091) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[2-(2-bromoethyl)pyrrolidin-1-yl]quinoline.
| Compound Name | 2-[2-(2-bromoethyl)pyrrolidin-1-yl]quinoline |
|---|---|
| PubChem CID | 112748091 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[2-(2-bromoethyl)pyrrolidin-1-yl]quinoline |
| SMILES | BrCCC1CCCN1c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H17BrN2/c16-10-9-13-5-3-11-18(13)15-8-7-12-4-1-2-6-14(12)17-15/h1-2,4,6-8,13H,3,5,9-11H2 |
| InChIKey | CZHHJTMKEOXJDI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|