C19H25N3 — CID 71192818
2-(4-pyrrolidin-1-ylazepan-1-yl)quinoline (PubChem CID 71192818) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylazepan-1-yl)quinoline.
| Compound Name | 2-(4-pyrrolidin-1-ylazepan-1-yl)quinoline |
|---|---|
| PubChem CID | 71192818 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylazepan-1-yl)quinoline |
| SMILES | c1ccc2nc(N3CCCC(N4CCCC4)CC3)ccc2c1 |
| InChI | InChI=1S/C19H25N3/c1-2-8-18-16(6-1)9-10-19(20-18)22-14-5-7-17(11-15-22)21-12-3-4-13-21/h1-2,6,8-10,17H,3-5,7,11-15H2 |
| InChIKey | CEZIXIQXTIPYLV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |